C8H12N2 — CID 142029984
(Z)-N,3-dimethylpent-2-enimidoyl cyanide (PubChem CID 142029984) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (Z)-N,3-dimethylpent-2-enimidoyl cyanide.
| Compound Name | (Z)-N,3-dimethylpent-2-enimidoyl cyanide |
|---|---|
| PubChem CID | 142029984 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (Z)-N,3-dimethylpent-2-enimidoyl cyanide |
| SMILES | CC/C(C)=C\C(C#N)=N\C |
| InChI | InChI=1S/C8H12N2/c1-4-7(2)5-8(6-9)10-3/h5H,4H2,1-3H3/b7-5-,10-8- |
| InChIKey | LZKNXIYIOPRLMB-RRMOSLQNSA-N |
| XLogP | 1.94 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|