About 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine
1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine (PubChem CID 142030264) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine.
Molecular Properties
| Compound Name | 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine |
| PubChem CID | 142030264 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CC=C(OC)C(C)=CC1 |
| InChI | InChI=1S/C11H15NO/c1-8-4-5-10(9(2)12)6-7-11(8)13-3/h4,6-7,12H,5H2,1-3H3/b12-9+ |
| InChIKey | YGSDNDBXORYJPD-FMIVXFBMSA-N |
| XLogP | 2.83 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine?
The IUPAC name of 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine (CID 142030264) is 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine.
What is the SMILES notation for 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine?
The canonical SMILES for 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine is [H]/N=C(\C)C1=CC=C(OC)C(C)=CC1.
What is the InChIKey of 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine?
The InChIKey is YGSDNDBXORYJPD-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H15NO/c1-8-4-5-10(9(2)12)6-7-11(8)13-3/h4,6-7,12H,5H2,1-3H3/b12-9+.
What are the key properties of 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine?
1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine has a molecular weight of 177.25 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-5-methylcyclohepta-1,3,5-trien-1-yl)ethanimine is sourced from PubChem (CID 142030264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).