C14H19N3O2 — CID 142030316
6-[[(3Z)-4-ethyl-5-methylhexa-1,3,5-trien-2-yl]amino]-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 142030316) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-[[(3Z)-4-ethyl-5-methylhexa-1,3,5-trien-2-yl]amino]-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[(3Z)-4-ethyl-5-methylhexa-1,3,5-trien-2-yl]amino]-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142030316 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-[[(3Z)-4-ethyl-5-methylhexa-1,3,5-trien-2-yl]amino]-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | C=C(/C=C(/CC)C(=C)C)Nc1cc(=O)n(C)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N3O2/c1-6-11(9(2)3)7-10(4)15-12-8-13(18)17(5)14(19)16-12/h7-8,15H,2,4,6H2,1,3,5H3,(H,16,19)/b11-7- |
| InChIKey | KIPZKQPDOZQZKS-XFFZJAGNSA-N |
| XLogP | 1.91 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|