About N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide
N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide (PubChem CID 142030407) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide.
Molecular Properties
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide |
| PubChem CID | 142030407 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide |
| SMILES | C=C/C=C(\C=C)N(C)C(=O)CC |
| InChI | InChI=1S/C10H15NO/c1-5-8-9(6-2)11(4)10(12)7-3/h5-6,8H,1-2,7H2,3-4H3/b9-8+ |
| InChIKey | XUMVHSGTTWNOPT-CMDGGOBGSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide?
The IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide (CID 142030407) is N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide.
What is the SMILES notation for N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide?
The canonical SMILES for N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide is C=C/C=C(\C=C)N(C)C(=O)CC.
What is the InChIKey of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide?
The InChIKey is XUMVHSGTTWNOPT-CMDGGOBGSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-8-9(6-2)11(4)10(12)7-3/h5-6,8H,1-2,7H2,3-4H3/b9-8+.
What are the key properties of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide?
N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide has a molecular weight of 165.24 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanamide is sourced from PubChem (CID 142030407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).