C21H30N4O — CID 142030607
1-(3-imidazol-1-ylpropyl)-3-[2-(5-methyl-5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)propan-2-yl]urea (PubChem CID 142030607) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[2-(5-methyl-5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)propan-2-yl]urea.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[2-(5-methyl-5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 142030607 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[2-(5-methyl-5-prop-1-en-2-ylcyclohepta-1,3,6-trien-1-yl)propan-2-yl]urea |
| SMILES | C=C(C)C1(C)C=CC=C(C(C)(C)NC(=O)NCCCn2ccnc2)C=C1 |
| InChI | InChI=1S/C21H30N4O/c1-17(2)21(5)10-6-8-18(9-11-21)20(3,4)24-19(26)23-12-7-14-25-15-13-22-16-25/h6,8-11,13,15-16H,1,7,12,14H2,2-5H3,(H2,23,24,26) |
| InChIKey | CWMGCKYKXLNBJJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|