About ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide
ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide (PubChem CID 142030699) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide.
Molecular Properties
| Compound Name | ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide |
| PubChem CID | 142030699 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide |
| SMILES | C=C/C=c1/cc(C(N)=O)cn/c1=C/C.CC |
| InChI | InChI=1S/C11H12N2O.C2H6/c1-3-5-8-6-9(11(12)14)7-13-10(8)4-2;1-2/h3-7H,1H2,2H3,(H2,12,14);1-2H3/b8-5-,10-4+; |
| InChIKey | JYFNQNUAUHEDEA-XPULTINCSA-N |
| XLogP | 0.97 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide?
The IUPAC name of ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide (CID 142030699) is ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide.
What is the SMILES notation for ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide?
The canonical SMILES for ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide is C=C/C=c1/cc(C(N)=O)cn/c1=C/C.CC.
What is the InChIKey of ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide?
The InChIKey is JYFNQNUAUHEDEA-XPULTINCSA-N. The full InChI is InChI=1S/C11H12N2O.C2H6/c1-3-5-8-6-9(11(12)14)7-13-10(8)4-2;1-2/h3-7H,1H2,2H3,(H2,12,14);1-2H3/b8-5-,10-4+;.
What are the key properties of ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide?
ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide has a molecular weight of 218.30 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxamide is sourced from PubChem (CID 142030699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).