C18H30OS — CID 142030879
4-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]sulfanyl-1-methoxy-2-propan-2-ylcyclohexene (PubChem CID 142030879) has the molecular formula C18H30OS and a molecular weight of 294.50 g/mol. Its IUPAC name is 4-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]sulfanyl-1-methoxy-2-propan-2-ylcyclohexene.
| Compound Name | 4-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]sulfanyl-1-methoxy-2-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 142030879 |
| Molecular Formula | C18H30OS |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 4-[(4Z)-2,4-dimethylhexa-2,4-dien-3-yl]sulfanyl-1-methoxy-2-propan-2-ylcyclohexene |
| SMILES | C/C=C(/C)C(SC1CCC(OC)=C(C(C)C)C1)=C(C)C |
| InChI | InChI=1S/C18H30OS/c1-8-14(6)18(13(4)5)20-15-9-10-17(19-7)16(11-15)12(2)3/h8,12,15H,9-11H2,1-7H3/b14-8- |
| InChIKey | PBILQQWJBOENCF-ZSOIEALJSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|