C22H20F2N4O3S — CID 142032031
N-[5-[(E)-N-[1-(4-amino-2-methyl-1,3-thiazol-5-yl)ethenoxy]-C-methylcarbonimidoyl]-2,4-difluorophenyl]-3-methoxybenzamide (PubChem CID 142032031) has the molecular formula C22H20F2N4O3S and a molecular weight of 458.49 g/mol. Its IUPAC name is N-[5-[(E)-N-[1-(4-amino-2-methyl-1,3-thiazol-5-yl)ethenoxy]-C-methylcarbonimidoyl]-2,4-difluorophenyl]-3-methoxybenzamide.
| Compound Name | N-[5-[(E)-N-[1-(4-amino-2-methyl-1,3-thiazol-5-yl)ethenoxy]-C-methylcarbonimidoyl]-2,4-difluorophenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 142032031 |
| Molecular Formula | C22H20F2N4O3S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[5-[(E)-N-[1-(4-amino-2-methyl-1,3-thiazol-5-yl)ethenoxy]-C-methylcarbonimidoyl]-2,4-difluorophenyl]-3-methoxybenzamide |
| SMILES | C=C(O/N=C(\C)c1cc(NC(=O)c2cccc(OC)c2)c(F)cc1F)c1sc(C)nc1N |
| InChI | InChI=1S/C22H20F2N4O3S/c1-11(28-31-12(2)20-21(25)26-13(3)32-20)16-9-19(18(24)10-17(16)23)27-22(29)14-6-5-7-15(8-14)30-4/h5-10H,2,25H2,1,3-4H3,(H,27,29)/b28-11+ |
| InChIKey | NZLKKYQNVONHAT-IPBVOBEMSA-N |
| XLogP | 4.98 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|