About ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride
ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride (PubChem CID 142032687) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride.
Molecular Properties
| Compound Name | ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride |
| PubChem CID | 142032687 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride |
| SMILES | C=C/C=c1/c(C(=O)C(=O)Cl)c[nH]/c1=C/C.CC |
| InChI | InChI=1S/C11H10ClNO2.C2H6/c1-3-5-7-8(10(14)11(12)15)6-13-9(7)4-2;1-2/h3-6,13H,1H2,2H3;1-2H3/b7-5-,9-4+; |
| InChIKey | RIICXTKWMSVNGB-DRVLAFEUSA-N |
| XLogP | 1.76 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
The IUPAC name of ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride (CID 142032687) is ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride.
What is the SMILES notation for ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
The canonical SMILES for ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride is C=C/C=c1/c(C(=O)C(=O)Cl)c[nH]/c1=C/C.CC.
What is the InChIKey of ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
The InChIKey is RIICXTKWMSVNGB-DRVLAFEUSA-N. The full InChI is InChI=1S/C11H10ClNO2.C2H6/c1-3-5-7-8(10(14)11(12)15)6-13-9(7)4-2;1-2/h3-6,13H,1H2,2H3;1-2H3/b7-5-,9-4+;.
What are the key properties of ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride has a molecular weight of 253.73 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(4Z,5E)-5-ethylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]-2-oxoacetyl chloride is sourced from PubChem (CID 142032687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).