About 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride
2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride (PubChem CID 142032730) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride.
Molecular Properties
| Compound Name | 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride |
| PubChem CID | 142032730 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride |
| SMILES | C/C=c1/c(C(=O)C(=O)Cl)c[nH]/c1=C/C |
| InChI | InChI=1S/C10H10ClNO2/c1-3-6-7(9(13)10(11)14)5-12-8(6)4-2/h3-5,12H,1-2H3/b6-3-,8-4+ |
| InChIKey | TZWAEHPIMLVTHI-TTZRGRENSA-N |
| XLogP | 0.56 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
The IUPAC name of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride (CID 142032730) is 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride.
What is the SMILES notation for 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
The canonical SMILES for 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride is C/C=c1/c(C(=O)C(=O)Cl)c[nH]/c1=C/C.
What is the InChIKey of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
The InChIKey is TZWAEHPIMLVTHI-TTZRGRENSA-N. The full InChI is InChI=1S/C10H10ClNO2/c1-3-6-7(9(13)10(11)14)5-12-8(6)4-2/h3-5,12H,1-2H3/b6-3-,8-4+.
What are the key properties of 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride?
2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride has a molecular weight of 211.65 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4Z,5E)-4,5-di(ethylidene)-1H-pyrrol-3-yl]-2-oxoacetyl chloride is sourced from PubChem (CID 142032730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).