C34H46N4O — CID 142032939
N-[(3R)-3-[[4-(3-benzyl-1-ethylpyrazol-5-yl)piperidin-1-yl]methyl]cyclopentyl]-N-methylbenzamide;prop-1-ene (PubChem CID 142032939) has the molecular formula C34H46N4O and a molecular weight of 526.77 g/mol. Its IUPAC name is N-[(3R)-3-[[4-(3-benzyl-1-ethylpyrazol-5-yl)piperidin-1-yl]methyl]cyclopentyl]-N-methylbenzamide;prop-1-ene.
| Compound Name | N-[(3R)-3-[[4-(3-benzyl-1-ethylpyrazol-5-yl)piperidin-1-yl]methyl]cyclopentyl]-N-methylbenzamide;prop-1-ene |
|---|---|
| PubChem CID | 142032939 |
| Molecular Formula | C34H46N4O |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | N-[(3R)-3-[[4-(3-benzyl-1-ethylpyrazol-5-yl)piperidin-1-yl]methyl]cyclopentyl]-N-methylbenzamide;prop-1-ene |
| SMILES | C=CC.CCn1nc(Cc2ccccc2)cc1C1CCN(C[C@@H]2CCC(N(C)C(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C31H40N4O.C3H6/c1-3-35-30(22-28(32-35)20-24-10-6-4-7-11-24)26-16-18-34(19-17-26)23-25-14-15-29(21-25)33(2)31(36)27-12-8-5-9-13-27;1-3-2/h4-13,22,25-26,29H,3,14-21,23H2,1-2H3;3H,1H2,2H3/t25-,29?;/m1./s1 |
| InChIKey | KBTWWYFLGANECB-JAJOJNMGSA-N |
| XLogP | 6.81 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|