About 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine
1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine (PubChem CID 142033316) has the molecular formula C22H34FN
and a molecular weight of 331.52 g/mol. Its IUPAC name is 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine.
Molecular Properties
| Compound Name | 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine |
| PubChem CID | 142033316 |
| Molecular Formula | C22H34FN |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine |
| SMILES | CC1CC(C)C(CN2CCC(CCCc3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C22H34FN/c1-17-14-18(2)21(15-17)16-24-12-10-20(11-13-24)5-3-4-19-6-8-22(23)9-7-19/h6-9,17-18,20-21H,3-5,10-16H2,1-2H3 |
| InChIKey | PBPOEYXNVDNWHI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine?
The IUPAC name of 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine (CID 142033316) is 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine.
What is the SMILES notation for 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine?
The canonical SMILES for 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine is CC1CC(C)C(CN2CCC(CCCc3ccc(F)cc3)CC2)C1.
What is the InChIKey of 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine?
The InChIKey is PBPOEYXNVDNWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34FN/c1-17-14-18(2)21(15-17)16-24-12-10-20(11-13-24)5-3-4-19-6-8-22(23)9-7-19/h6-9,17-18,20-21H,3-5,10-16H2,1-2H3.
What are the key properties of 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine?
1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine has a molecular weight of 331.52 g/mol, XLogP of 5.54, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethylcyclopentyl)methyl]-4-[3-(4-fluorophenyl)propyl]piperidine is sourced from PubChem (CID 142033316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).