C37H52N2O2 — CID 142033537
6-[(3S,4S)-3-[[4-[3-(4-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-phenylcyclopentyl]-2-(2-methylpropyl)hexanoic acid (PubChem CID 142033537) has the molecular formula C37H52N2O2 and a molecular weight of 556.84 g/mol. Its IUPAC name is 6-[(3S,4S)-3-[[4-[3-(4-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-phenylcyclopentyl]-2-(2-methylpropyl)hexanoic acid.
| Compound Name | 6-[(3S,4S)-3-[[4-[3-(4-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-phenylcyclopentyl]-2-(2-methylpropyl)hexanoic acid |
|---|---|
| PubChem CID | 142033537 |
| Molecular Formula | C37H52N2O2 |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | 6-[(3S,4S)-3-[[4-[3-(4-cyanophenyl)propyl]piperidin-1-yl]methyl]-4-phenylcyclopentyl]-2-(2-methylpropyl)hexanoic acid |
| SMILES | CC(C)CC(CCCCC1C[C@H](CN2CCC(CCCc3ccc(C#N)cc3)CC2)[C@@H](c2ccccc2)C1)C(=O)O |
| InChI | InChI=1S/C37H52N2O2/c1-28(2)23-34(37(40)41)14-7-6-9-32-24-35(36(25-32)33-12-4-3-5-13-33)27-39-21-19-30(20-22-39)11-8-10-29-15-17-31(26-38)18-16-29/h3-5,12-13,15-18,28,30,32,34-36H,6-11,14,19-25,27H2,1-2H3,(H,40,41)/t32?,34?,35-,36-/m1/s1 |
| InChIKey | FQMGZAYAHJUOTC-NSBHYTKHSA-N |
| XLogP | 8.71 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|