C10H22OSi — CID 14203368
(2R,3R)-3-methyl-4-trimethylsilylhex-5-en-2-ol (PubChem CID 14203368) has the molecular formula C10H22OSi and a molecular weight of 186.37 g/mol. Its IUPAC name is (2R,3R)-3-methyl-4-trimethylsilylhex-5-en-2-ol.
| Compound Name | (2R,3R)-3-methyl-4-trimethylsilylhex-5-en-2-ol |
|---|---|
| PubChem CID | 14203368 |
| Molecular Formula | C10H22OSi |
| Molecular Weight | 186.37 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2R,3R)-3-methyl-4-trimethylsilylhex-5-en-2-ol |
| SMILES | C=CC([C@H](C)[C@@H](C)O)[Si](C)(C)C |
| InChI | InChI=1S/C10H22OSi/c1-7-10(12(4,5)6)8(2)9(3)11/h7-11H,1H2,2-6H3/t8-,9-,10?/m1/s1 |
| InChIKey | WMULZANMHCAYRB-MGRQHWMJSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|