C38H50FN3O2 — CID 142033756
3-cyclopropyl-2-[(4S)-3-[[4-[1-ethyl-3-[(4-propan-2-ylphenyl)methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)cyclopentyl]propanoic acid (PubChem CID 142033756) has the molecular formula C38H50FN3O2 and a molecular weight of 599.84 g/mol. Its IUPAC name is 3-cyclopropyl-2-[(4S)-3-[[4-[1-ethyl-3-[(4-propan-2-ylphenyl)methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)cyclopentyl]propanoic acid.
| Compound Name | 3-cyclopropyl-2-[(4S)-3-[[4-[1-ethyl-3-[(4-propan-2-ylphenyl)methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 142033756 |
| Molecular Formula | C38H50FN3O2 |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.39 |
| IUPAC Name | 3-cyclopropyl-2-[(4S)-3-[[4-[1-ethyl-3-[(4-propan-2-ylphenyl)methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)cyclopentyl]propanoic acid |
| SMILES | CCn1nc(Cc2ccc(C(C)C)cc2)cc1C1CCN(CC2CC(C(CC3CC3)C(=O)O)C[C@@H]2c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C38H50FN3O2/c1-4-42-37(23-34(40-42)18-26-10-12-28(13-11-26)25(2)3)29-14-16-41(17-15-29)24-32-20-31(36(38(43)44)19-27-8-9-27)22-35(32)30-6-5-7-33(39)21-30/h5-7,10-13,21,23,25,27,29,31-32,35-36H,4,8-9,14-20,22,24H2,1-3H3,(H,43,44)/t31?,32?,35-,36?/m1/s1 |
| InChIKey | MZVAACLSBYDDSB-YKAIRFRRSA-N |
| XLogP | 8.25 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |