C9H14O3 — CID 142033867
1-[(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]propan-2-one (PubChem CID 142033867) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-[(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]propan-2-one.
| Compound Name | 1-[(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]propan-2-one |
|---|---|
| PubChem CID | 142033867 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-[(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1COC2OCCC21 |
| InChI | InChI=1S/C9H14O3/c1-6(10)4-7-5-12-9-8(7)2-3-11-9/h7-9H,2-5H2,1H3/t7-,8?,9?/m0/s1 |
| InChIKey | XOQILZTWNIBYBP-UEJVZZJDSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |