C14H18N2O — CID 142034096
1-[(4-ethylphenoxy)methyl]-3,5-dimethylpyrazole (PubChem CID 142034096) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[(4-ethylphenoxy)methyl]-3,5-dimethylpyrazole.
| Compound Name | 1-[(4-ethylphenoxy)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 142034096 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-[(4-ethylphenoxy)methyl]-3,5-dimethylpyrazole |
| SMILES | CCc1ccc(OCn2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C14H18N2O/c1-4-13-5-7-14(8-6-13)17-10-16-12(3)9-11(2)15-16/h5-9H,4,10H2,1-3H3 |
| InChIKey | CDOIPZZFONYWGR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |