About cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane
cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane (PubChem CID 142034261) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane |
| PubChem CID | 142034261 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane |
| SMILES | CCC.CCCC1CCCN1C(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C14H21NO.C3H8/c1-2-7-13-10-6-11-15(13)14(16)12-8-4-3-5-9-12;1-3-2/h4,8-9,13H,2-3,5-7,10-11H2,1H3;3H2,1-2H3 |
| InChIKey | PLEQSNSIIJJONK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane?
The IUPAC name of cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane (CID 142034261) is cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane.
What is the SMILES notation for cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane?
The canonical SMILES for cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane is CCC.CCCC1CCCN1C(=O)C1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane?
The InChIKey is PLEQSNSIIJJONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO.C3H8/c1-2-7-13-10-6-11-15(13)14(16)12-8-4-3-5-9-12;1-3-2/h4,8-9,13H,2-3,5-7,10-11H2,1H3;3H2,1-2H3.
What are the key properties of cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane?
cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane has a molecular weight of 263.43 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-yl-(2-propylpyrrolidin-1-yl)methanone;propane is sourced from PubChem (CID 142034261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).