C17H25N3O2 — CID 142035039
N,2-dimethylpropan-1-amine;4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzaldehyde (PubChem CID 142035039) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N,2-dimethylpropan-1-amine;4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzaldehyde.
| Compound Name | N,2-dimethylpropan-1-amine;4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 142035039 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N,2-dimethylpropan-1-amine;4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)benzaldehyde |
| SMILES | CC1CC(=O)NN=C1c1ccc(C=O)cc1.CNCC(C)C |
| InChI | InChI=1S/C12H12N2O2.C5H13N/c1-8-6-11(16)13-14-12(8)10-4-2-9(7-15)3-5-10;1-5(2)4-6-3/h2-5,7-8H,6H2,1H3,(H,13,16);5-6H,4H2,1-3H3 |
| InChIKey | GYWMRMYGWSZPSN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|