About 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one
11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one (PubChem CID 14203513) has the molecular formula C16H15NO2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one |
| PubChem CID | 14203513 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one |
| SMILES | CN1C(=O)c2ccccc2C(C)(O)c2ccccc21 |
| InChI | InChI=1S/C16H15NO2/c1-16(19)12-8-4-3-7-11(12)15(18)17(2)14-10-6-5-9-13(14)16/h3-10,19H,1-2H3 |
| InChIKey | FUHPWGWYCSWSIC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one?
The IUPAC name of 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one (CID 14203513) is 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one.
What is the SMILES notation for 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one?
The canonical SMILES for 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one is CN1C(=O)c2ccccc2C(C)(O)c2ccccc21.
What is the InChIKey of 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one?
The InChIKey is FUHPWGWYCSWSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2/c1-16(19)12-8-4-3-7-11(12)15(18)17(2)14-10-6-5-9-13(14)16/h3-10,19H,1-2H3.
What are the key properties of 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one?
11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one has a molecular weight of 253.30 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxy-5,11-dimethylbenzo[c][1]benzazepin-6-one is sourced from PubChem (CID 14203513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).