C17H15F3O — CID 142035349
6-methyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 142035349) has the molecular formula C17H15F3O and a molecular weight of 292.30 g/mol. Its IUPAC name is 6-methyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol.
| Compound Name | 6-methyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 142035349 |
| Molecular Formula | C17H15F3O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 6-methyl-2-(3,4,5-trifluorophenyl)-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | Cc1ccc2c(c1)CCC(O)(c1cc(F)c(F)c(F)c1)C2 |
| InChI | InChI=1S/C17H15F3O/c1-10-2-3-12-9-17(21,5-4-11(12)6-10)13-7-14(18)16(20)15(19)8-13/h2-3,6-8,21H,4-5,9H2,1H3 |
| InChIKey | MPGAROKNXAVKTI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|