C22H25F2NOS — CID 142035398
4-aminosulfanyl-1-[6-(3,4-difluorophenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexan-1-ol (PubChem CID 142035398) has the molecular formula C22H25F2NOS and a molecular weight of 389.51 g/mol. Its IUPAC name is 4-aminosulfanyl-1-[6-(3,4-difluorophenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexan-1-ol.
| Compound Name | 4-aminosulfanyl-1-[6-(3,4-difluorophenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 142035398 |
| Molecular Formula | C22H25F2NOS |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 4-aminosulfanyl-1-[6-(3,4-difluorophenyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexan-1-ol |
| SMILES | NSC1CCC(O)(c2ccc3c(c2)CCC(c2ccc(F)c(F)c2)C3)CC1 |
| InChI | InChI=1S/C22H25F2NOS/c23-20-6-4-17(13-21(20)24)14-1-2-16-12-18(5-3-15(16)11-14)22(26)9-7-19(27-25)8-10-22/h3-6,12-14,19,26H,1-2,7-11,25H2 |
| InChIKey | DGWOVISPCNWYLM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|