About N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane
N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane (PubChem CID 142035471) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane.
Molecular Properties
| Compound Name | N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane |
| PubChem CID | 142035471 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane |
| SMILES | C/C=C(/C)N/C=N/C.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-4-6(2)8-5-7-3;1-2/h4-5H,1-3H3,(H,7,8);1-2H3/b6-4-; |
| InChIKey | RCNJVWZPAKLQPG-YHSAGPEESA-N |
| XLogP | 2.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane?
The IUPAC name of N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane (CID 142035471) is N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane.
What is the SMILES notation for N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane?
The canonical SMILES for N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane is C/C=C(/C)N/C=N/C.CC.
What is the InChIKey of N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane?
The InChIKey is RCNJVWZPAKLQPG-YHSAGPEESA-N. The full InChI is InChI=1S/C6H12N2.C2H6/c1-4-6(2)8-5-7-3;1-2/h4-5H,1-3H3,(H,7,8);1-2H3/b6-4-;.
What are the key properties of N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane?
N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane has a molecular weight of 142.25 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-2-en-2-yl]-N'-methylmethanimidamide;ethane is sourced from PubChem (CID 142035471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).