C40H54Cl2N8O3 — CID 142035903
N-benzyl-2-[[2-[[3-[(2,6-dichlorophenyl)methylamino]-4-(2-pyrrolidin-1-ylethanimidoyl)phenyl]carbamoylamino]acetyl]amino]-4-(heptylamino)butanamide (PubChem CID 142035903) has the molecular formula C40H54Cl2N8O3 and a molecular weight of 765.83 g/mol. Its IUPAC name is N-benzyl-2-[[2-[[3-[(2,6-dichlorophenyl)methylamino]-4-(2-pyrrolidin-1-ylethanimidoyl)phenyl]carbamoylamino]acetyl]amino]-4-(heptylamino)butanamide.
| Compound Name | N-benzyl-2-[[2-[[3-[(2,6-dichlorophenyl)methylamino]-4-(2-pyrrolidin-1-ylethanimidoyl)phenyl]carbamoylamino]acetyl]amino]-4-(heptylamino)butanamide |
|---|---|
| PubChem CID | 142035903 |
| Molecular Formula | C40H54Cl2N8O3 |
| Molecular Weight | 765.83 g/mol |
| Exact Mass | 764.37 |
| IUPAC Name | N-benzyl-2-[[2-[[3-[(2,6-dichlorophenyl)methylamino]-4-(2-pyrrolidin-1-ylethanimidoyl)phenyl]carbamoylamino]acetyl]amino]-4-(heptylamino)butanamide |
| SMILES | [H]/N=C(\CN1CCCC1)c1ccc(NC(=O)NCC(=O)NC(CCNCCCCCCC)C(=O)NCc2ccccc2)cc1NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C40H54Cl2N8O3/c1-2-3-4-5-9-20-44-21-19-36(39(52)46-25-29-13-7-6-8-14-29)49-38(51)27-47-40(53)48-30-17-18-31(35(43)28-50-22-10-11-23-50)37(24-30)45-26-32-33(41)15-12-16-34(32)42/h6-8,12-18,24,36,43-45H,2-5,9-11,19-23,25-28H2,1H3,(H,46,52)(H,49,51)(H2,47,48,53)/b43-35+ |
| InChIKey | BSBQFQFOYKJUEB-AMOOHMQNSA-N |
| XLogP | 6.94 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.83 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|