C33H38BrN3O5 — CID 142036481
4-[[1-[2-[4-[[[[(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]amino]-cyclobutylidenemethyl]amino]-3-methoxyphenyl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid (PubChem CID 142036481) has the molecular formula C33H38BrN3O5 and a molecular weight of 636.59 g/mol. Its IUPAC name is 4-[[1-[2-[4-[[[[(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]amino]-cyclobutylidenemethyl]amino]-3-methoxyphenyl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid.
| Compound Name | 4-[[1-[2-[4-[[[[(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]amino]-cyclobutylidenemethyl]amino]-3-methoxyphenyl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 142036481 |
| Molecular Formula | C33H38BrN3O5 |
| Molecular Weight | 636.59 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | 4-[[1-[2-[4-[[[[(1Z,3Z,5Z)-1-bromohepta-1,3,5-trien-2-yl]amino]-cyclobutylidenemethyl]amino]-3-methoxyphenyl]acetyl]pyrrolidin-2-yl]methoxy]benzoic acid |
| SMILES | C/C=C\C=C/C(=C/Br)NC(Nc1ccc(CC(=O)N2CCCC2COc2ccc(C(=O)O)cc2)cc1OC)=C1CCC1 |
| InChI | InChI=1S/C33H38BrN3O5/c1-3-4-5-10-26(21-34)35-32(24-8-6-9-24)36-29-17-12-23(19-30(29)41-2)20-31(38)37-18-7-11-27(37)22-42-28-15-13-25(14-16-28)33(39)40/h3-5,10,12-17,19,21,27,35-36H,6-9,11,18,20,22H2,1-2H3,(H,39,40)/b4-3-,10-5-,26-21- |
| InChIKey | AELVHUMNKXIBIR-GEUXPPHKSA-N |
| XLogP | 6.77 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|