About 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one
3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one (PubChem CID 142036948) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one.
Molecular Properties
| Compound Name | 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one |
| PubChem CID | 142036948 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one |
| SMILES | CCC1(CC)C(=O)OCC(C)(C)N1NC |
| InChI | InChI=1S/C11H22N2O2/c1-6-11(7-2)9(14)15-8-10(3,4)13(11)12-5/h12H,6-8H2,1-5H3 |
| InChIKey | KMACTRQANZDZIZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one?
The IUPAC name of 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one (CID 142036948) is 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one.
What is the SMILES notation for 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one?
The canonical SMILES for 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one is CCC1(CC)C(=O)OCC(C)(C)N1NC.
What is the InChIKey of 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one?
The InChIKey is KMACTRQANZDZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-6-11(7-2)9(14)15-8-10(3,4)13(11)12-5/h12H,6-8H2,1-5H3.
What are the key properties of 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one?
3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one has a molecular weight of 214.31 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-5,5-dimethyl-4-(methylamino)morpholin-2-one is sourced from PubChem (CID 142036948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).