C12H20N2S — CID 142036994
3-[(Z)-prop-1-enyl]-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-2-thione (PubChem CID 142036994) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 3-[(Z)-prop-1-enyl]-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-2-thione.
| Compound Name | 3-[(Z)-prop-1-enyl]-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-2-thione |
|---|---|
| PubChem CID | 142036994 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-[(Z)-prop-1-enyl]-4,5,5a,6,7,8,9,9a-octahydro-1H-benzo[d][1,3]diazepine-2-thione |
| SMILES | C/C=C\N1CCC2CCCCC2NC1=S |
| InChI | InChI=1S/C12H20N2S/c1-2-8-14-9-7-10-5-3-4-6-11(10)13-12(14)15/h2,8,10-11H,3-7,9H2,1H3,(H,13,15)/b8-2- |
| InChIKey | DEWCLPDWAYEODE-WAPJZHGLSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|