C24H21N3O4Sn — CID 142037667
3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N,7-dimethyl-N-(3-nitrophenyl)-6,7-dihydro-2,1λ2-benzazastannol-6-amine (PubChem CID 142037667) has the molecular formula C24H21N3O4Sn and a molecular weight of 534.16 g/mol. Its IUPAC name is 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N,7-dimethyl-N-(3-nitrophenyl)-6,7-dihydro-2,1λ2-benzazastannol-6-amine.
| Compound Name | 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N,7-dimethyl-N-(3-nitrophenyl)-6,7-dihydro-2,1λ2-benzazastannol-6-amine |
|---|---|
| PubChem CID | 142037667 |
| Molecular Formula | C24H21N3O4Sn |
| Molecular Weight | 534.16 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 3-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-N,7-dimethyl-N-(3-nitrophenyl)-6,7-dihydro-2,1λ2-benzazastannol-6-amine |
| SMILES | CC1C2=C(C=CC1N(C)c1cccc([N+](=O)[O-])c1)C(/C=C/c1ccc3c(c1)OCO3)=N[Sn]2 |
| InChI | InChI=1S/C24H21N3O4.Sn/c1-16-12-18(21(25)9-6-17-7-11-23-24(13-17)31-15-30-23)8-10-22(16)26(2)19-4-3-5-20(14-19)27(28)29;/h3-11,13-14,16,22H,15H2,1-2H3;/q-1;+1/b9-6+; |
| InChIKey | FKKAXSWKBXTYIC-MLBSPLJJSA-N |
| XLogP | 4.38 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|