C13H23NO5 — CID 142037846
(2S)-4-hydroxy-2-methyl-2-(6-oxooctanoylamino)butanoic acid (PubChem CID 142037846) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-methyl-2-(6-oxooctanoylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-methyl-2-(6-oxooctanoylamino)butanoic acid |
|---|---|
| PubChem CID | 142037846 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (2S)-4-hydroxy-2-methyl-2-(6-oxooctanoylamino)butanoic acid |
| SMILES | CCC(=O)CCCCC(=O)N[C@@](C)(CCO)C(=O)O |
| InChI | InChI=1S/C13H23NO5/c1-3-10(16)6-4-5-7-11(17)14-13(2,8-9-15)12(18)19/h15H,3-9H2,1-2H3,(H,14,17)(H,18,19)/t13-/m0/s1 |
| InChIKey | XDNLLFAKMSJJIA-ZDUSSCGKSA-N |
| XLogP | 0.87 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|