C18H21N5O3 — CID 142038089
2-[diazenyl(methanimidoyl)amino]-N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]acetamide (PubChem CID 142038089) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-[diazenyl(methanimidoyl)amino]-N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]acetamide.
| Compound Name | 2-[diazenyl(methanimidoyl)amino]-N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 142038089 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[diazenyl(methanimidoyl)amino]-N-[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl]acetamide |
| SMILES | [H]/N=C/N(CC(=O)Nc1ccc(CC23CC(=C)CC2COC3=O)cc1)/N=N/[H] |
| InChI | InChI=1S/C18H21N5O3/c1-12-6-14-10-26-17(25)18(14,7-12)8-13-2-4-15(5-3-13)21-16(24)9-23(11-19)22-20/h2-5,11,14,19-20H,1,6-10H2,(H,21,24)/b19-11+,22-20+ |
| InChIKey | AWAWNSUGNOMVBV-CVJNMRINSA-N |
| XLogP | 2.53 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|