C16H27N3O4 — CID 14203816
19-methoxy-6,9,12-trioxa-3,15,21-triazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene (PubChem CID 14203816) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 19-methoxy-6,9,12-trioxa-3,15,21-triazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene.
| Compound Name | 19-methoxy-6,9,12-trioxa-3,15,21-triazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene |
|---|---|
| PubChem CID | 14203816 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 19-methoxy-6,9,12-trioxa-3,15,21-triazabicyclo[15.3.1]henicosa-1(20),17(21),18-triene |
| SMILES | COc1cc2nc(c1)CNCCOCCOCCOCCNC2 |
| InChI | InChI=1S/C16H27N3O4/c1-20-16-10-14-12-17-2-4-21-6-8-23-9-7-22-5-3-18-13-15(11-16)19-14/h10-11,17-18H,2-9,12-13H2,1H3 |
| InChIKey | ZTWPBVVBDIKGFZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |