C25H28O5S — CID 142038288
[4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 4-tert-butylbenzenesulfonate (PubChem CID 142038288) has the molecular formula C25H28O5S and a molecular weight of 440.56 g/mol. Its IUPAC name is [4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 4-tert-butylbenzenesulfonate.
| Compound Name | [4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 4-tert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 142038288 |
| Molecular Formula | C25H28O5S |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [4-[(5-methylidene-3-oxo-1,4,6,6a-tetrahydrocyclopenta[c]furan-3a-yl)methyl]phenyl] 4-tert-butylbenzenesulfonate |
| SMILES | C=C1CC2COC(=O)C2(Cc2ccc(OS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2)C1 |
| InChI | InChI=1S/C25H28O5S/c1-17-13-20-16-29-23(26)25(20,14-17)15-18-5-9-21(10-6-18)30-31(27,28)22-11-7-19(8-12-22)24(2,3)4/h5-12,20H,1,13-16H2,2-4H3 |
| InChIKey | UGQAWPLWICTKRW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|