C23H31BrN2O3 — CID 142038336
3a-[[3-bromo-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 142038336) has the molecular formula C23H31BrN2O3 and a molecular weight of 463.42 g/mol. Its IUPAC name is 3a-[[3-bromo-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | 3a-[[3-bromo-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 142038336 |
| Molecular Formula | C23H31BrN2O3 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3a-[[3-bromo-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]methyl]-5-methylidene-1,4,6,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | C=C1CC2COC(=O)C2(Cc2ccc(OCCCN3CCN(C)CC3)c(Br)c2)C1 |
| InChI | InChI=1S/C23H31BrN2O3/c1-17-12-19-16-29-22(27)23(19,14-17)15-18-4-5-21(20(24)13-18)28-11-3-6-26-9-7-25(2)8-10-26/h4-5,13,19H,1,3,6-12,14-16H2,2H3 |
| InChIKey | KAEXRXFKIPHORC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|