C12H21NO5 — CID 142038722
1-(3,3-dimethyl-2-oxopentanoyl)azetidine-2-carboxylic acid;methanol (PubChem CID 142038722) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxopentanoyl)azetidine-2-carboxylic acid;methanol.
| Compound Name | 1-(3,3-dimethyl-2-oxopentanoyl)azetidine-2-carboxylic acid;methanol |
|---|---|
| PubChem CID | 142038722 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxopentanoyl)azetidine-2-carboxylic acid;methanol |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC1C(=O)O.CO |
| InChI | InChI=1S/C11H17NO4.CH4O/c1-4-11(2,3)8(13)9(14)12-6-5-7(12)10(15)16;1-2/h7H,4-6H2,1-3H3,(H,15,16);2H,1H3 |
| InChIKey | PDBLLIRMSLRROI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|