C22H34FN7O5 — CID 142038949
3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[4-fluorobutyl(methyl)amino]-4-oxopentanoic acid (PubChem CID 142038949) has the molecular formula C22H34FN7O5 and a molecular weight of 495.56 g/mol. Its IUPAC name is 3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[4-fluorobutyl(methyl)amino]-4-oxopentanoic acid.
| Compound Name | 3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[4-fluorobutyl(methyl)amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142038949 |
| Molecular Formula | C22H34FN7O5 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[4-fluorobutyl(methyl)amino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NC(CC(=O)O)C(=O)CN(C)CCCCF)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C22H34FN7O5/c1-4-17(30-10-8-26-20(22(30)35)27-12-15(25)14(2)24)21(34)28-16(11-19(32)33)18(31)13-29(3)9-6-5-7-23/h8,10,16-17,24-25H,4-7,9,11-13H2,1-3H3,(H,26,27)(H,28,34)(H,32,33)/b24-14+,25-15- |
| InChIKey | XSDBCYXEWIONSX-LUWDBDBNSA-N |
| XLogP | 0.88 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|