C24H38FN7O5 — CID 142038950
3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[6-fluorohexyl(methyl)amino]-4-oxopentanoic acid (PubChem CID 142038950) has the molecular formula C24H38FN7O5 and a molecular weight of 523.61 g/mol. Its IUPAC name is 3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[6-fluorohexyl(methyl)amino]-4-oxopentanoic acid.
| Compound Name | 3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[6-fluorohexyl(methyl)amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142038950 |
| Molecular Formula | C24H38FN7O5 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-5-[6-fluorohexyl(methyl)amino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NC(CC(=O)O)C(=O)CN(C)CCCCCCF)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C24H38FN7O5/c1-4-19(32-12-10-28-22(24(32)37)29-14-17(27)16(2)26)23(36)30-18(13-21(34)35)20(33)15-31(3)11-8-6-5-7-9-25/h10,12,18-19,26-27H,4-9,11,13-15H2,1-3H3,(H,28,29)(H,30,36)(H,34,35)/b26-16+,27-17- |
| InChIKey | WPBDGTGHPNDMJD-DWSYLPIJSA-N |
| XLogP | 1.66 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|