C26H35N7O5 — CID 142038951
5-[benzyl(ethyl)amino]-3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid (PubChem CID 142038951) has the molecular formula C26H35N7O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 5-[benzyl(ethyl)amino]-3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid.
| Compound Name | 5-[benzyl(ethyl)amino]-3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142038951 |
| Molecular Formula | C26H35N7O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 5-[benzyl(ethyl)amino]-3-[2-[3-(2,3-diiminobutylamino)-2-oxopyrazin-1-yl]butanoylamino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(CNc1nccn(C(CC)C(=O)NC(CC(=O)O)C(=O)CN(CC)Cc2ccccc2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C26H35N7O5/c1-4-21(33-12-11-29-24(26(33)38)30-14-19(28)17(3)27)25(37)31-20(13-23(35)36)22(34)16-32(5-2)15-18-9-7-6-8-10-18/h6-12,20-21,27-28H,4-5,13-16H2,1-3H3,(H,29,30)(H,31,37)(H,35,36)/b27-17+,28-19- |
| InChIKey | XBMHAXNEWAGBKW-JQTBANOFSA-N |
| XLogP | 1.72 |
| TPSA | 181.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|