C25H33N7O5 — CID 142038960
5-(1,3-dihydroisoindol-2-yl)-3-[2-[2-(2,3-diiminobutylimino)-3-hydroxy-1,3-dihydropyrazin-4-yl]butanoylamino]-4-oxopentanoic acid (PubChem CID 142038960) has the molecular formula C25H33N7O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is 5-(1,3-dihydroisoindol-2-yl)-3-[2-[2-(2,3-diiminobutylimino)-3-hydroxy-1,3-dihydropyrazin-4-yl]butanoylamino]-4-oxopentanoic acid.
| Compound Name | 5-(1,3-dihydroisoindol-2-yl)-3-[2-[2-(2,3-diiminobutylimino)-3-hydroxy-1,3-dihydropyrazin-4-yl]butanoylamino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 142038960 |
| Molecular Formula | C25H33N7O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 5-(1,3-dihydroisoindol-2-yl)-3-[2-[2-(2,3-diiminobutylimino)-3-hydroxy-1,3-dihydropyrazin-4-yl]butanoylamino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(C/N=C1\NC=CN(C(CC)C(=O)NC(CC(=O)O)C(=O)CN2Cc3ccccc3C2)C1O)\C(C)=N\[H] |
| InChI | InChI=1S/C25H33N7O5/c1-3-20(32-9-8-28-23(25(32)37)29-11-18(27)15(2)26)24(36)30-19(10-22(34)35)21(33)14-31-12-16-6-4-5-7-17(16)13-31/h4-9,19-20,25-27,37H,3,10-14H2,1-2H3,(H,28,29)(H,30,36)(H,34,35)/b26-15+,27-18- |
| InChIKey | FXYBQLGNQFANTL-CIUWNPIFSA-N |
| XLogP | 0.46 |
| TPSA | 182.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|