C25H37N7O6 — CID 142038985
3-[2-[3-[[(2Z)-3-amino-2-hydroxyiminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-hydroxy-5-(1-phenylethylamino)pentanoic acid (PubChem CID 142038985) has the molecular formula C25H37N7O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is 3-[2-[3-[[(2Z)-3-amino-2-hydroxyiminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-hydroxy-5-(1-phenylethylamino)pentanoic acid.
| Compound Name | 3-[2-[3-[[(2Z)-3-amino-2-hydroxyiminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-hydroxy-5-(1-phenylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 142038985 |
| Molecular Formula | C25H37N7O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 3-[2-[3-[[(2Z)-3-amino-2-hydroxyiminobutyl]amino]-2-oxopyrazin-1-yl]butanoylamino]-4-hydroxy-5-(1-phenylethylamino)pentanoic acid |
| SMILES | CCC(C(=O)NC(CC(=O)O)C(O)CNC(C)c1ccccc1)n1ccnc(NC/C(=N/O)C(C)N)c1=O |
| InChI | InChI=1S/C25H37N7O6/c1-4-20(32-11-10-27-23(25(32)37)29-13-19(31-38)15(2)26)24(36)30-18(12-22(34)35)21(33)14-28-16(3)17-8-6-5-7-9-17/h5-11,15-16,18,20-21,28,33,38H,4,12-14,26H2,1-3H3,(H,27,29)(H,30,36)(H,34,35)/b31-19- |
| InChIKey | JCIBSRZVJZKCKW-DXJNIWACSA-N |
| XLogP | 0.45 |
| TPSA | 204.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|