About ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate
ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate (PubChem CID 142039072) has the molecular formula C14H21N5O4
and a molecular weight of 323.35 g/mol. Its IUPAC name is ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate.
Molecular Properties
| Compound Name | ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate |
| PubChem CID | 142039072 |
| Molecular Formula | C14H21N5O4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate |
| SMILES | CC.CCOC(=O)Cn1ccnc(NCc2nonc2C)c1=O |
| InChI | InChI=1S/C12H15N5O4.C2H6/c1-3-20-10(18)7-17-5-4-13-11(12(17)19)14-6-9-8(2)15-21-16-9;1-2/h4-5H,3,6-7H2,1-2H3,(H,13,14);1-2H3 |
| InChIKey | WUKFIFGSXAQUNG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate?
The IUPAC name of ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate (CID 142039072) is ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate.
What is the SMILES notation for ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate?
The canonical SMILES for ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate is CC.CCOC(=O)Cn1ccnc(NCc2nonc2C)c1=O.
What is the InChIKey of ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate?
The InChIKey is WUKFIFGSXAQUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O4.C2H6/c1-3-20-10(18)7-17-5-4-13-11(12(17)19)14-6-9-8(2)15-21-16-9;1-2/h4-5H,3,6-7H2,1-2H3,(H,13,14);1-2H3.
What are the key properties of ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate?
ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate has a molecular weight of 323.35 g/mol, XLogP of 1.14, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-[3-[(4-methyl-1,2,5-oxadiazol-3-yl)methylamino]-2-oxopyrazin-1-yl]acetate is sourced from PubChem (CID 142039072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).