C23H30N6O3S — CID 142039145
N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-(2,3-diiminobutylamino)-5-methyl-2-oxopyrazin-1-yl]butanamide (PubChem CID 142039145) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-(2,3-diiminobutylamino)-5-methyl-2-oxopyrazin-1-yl]butanamide.
| Compound Name | N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-(2,3-diiminobutylamino)-5-methyl-2-oxopyrazin-1-yl]butanamide |
|---|---|
| PubChem CID | 142039145 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | N-(3-benzylsulfanyl-2-oxopropyl)-2-[3-(2,3-diiminobutylamino)-5-methyl-2-oxopyrazin-1-yl]butanamide |
| SMILES | [H]/N=C(CNc1nc(C)cn(C(CC)C(=O)NCC(=O)CSCc2ccccc2)c1=O)\C(C)=N\[H] |
| InChI | InChI=1S/C23H30N6O3S/c1-4-20(22(31)27-10-18(30)14-33-13-17-8-6-5-7-9-17)29-12-15(2)28-21(23(29)32)26-11-19(25)16(3)24/h5-9,12,20,24-25H,4,10-11,13-14H2,1-3H3,(H,26,28)(H,27,31)/b24-16+,25-19- |
| InChIKey | CWZVZMVGXLVLLJ-SDYLALEWSA-N |
| XLogP | 2.59 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|