C11H13N3O2 — CID 142039510
3,5-dimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole (PubChem CID 142039510) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3,5-dimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole.
| Compound Name | 3,5-dimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 142039510 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3,5-dimethyl-2-(4-nitrophenyl)-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2)C(C)C1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-7-9(2)13(12-8)10-3-5-11(6-4-10)14(15)16/h3-6,9H,7H2,1-2H3 |
| InChIKey | FHGUEFSDUJRPNP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|