C32H41ClFN7 — CID 142039679
2-N-[(3-chlorophenyl)methyl]-4-N-[2-[(4-fluorophenyl)methylamino]ethyl]-6-imidazol-1-ylpyrimidine-2,4-diamine;ethene;methylcyclohexane (PubChem CID 142039679) has the molecular formula C32H41ClFN7 and a molecular weight of 578.18 g/mol. Its IUPAC name is 2-N-[(3-chlorophenyl)methyl]-4-N-[2-[(4-fluorophenyl)methylamino]ethyl]-6-imidazol-1-ylpyrimidine-2,4-diamine;ethene;methylcyclohexane.
| Compound Name | 2-N-[(3-chlorophenyl)methyl]-4-N-[2-[(4-fluorophenyl)methylamino]ethyl]-6-imidazol-1-ylpyrimidine-2,4-diamine;ethene;methylcyclohexane |
|---|---|
| PubChem CID | 142039679 |
| Molecular Formula | C32H41ClFN7 |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | 2-N-[(3-chlorophenyl)methyl]-4-N-[2-[(4-fluorophenyl)methylamino]ethyl]-6-imidazol-1-ylpyrimidine-2,4-diamine;ethene;methylcyclohexane |
| SMILES | C=C.CC1CCCCC1.Fc1ccc(CNCCNc2cc(-n3ccnc3)nc(NCc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C23H23ClFN7.C7H14.C2H4/c24-19-3-1-2-18(12-19)15-29-23-30-21(13-22(31-23)32-11-10-27-16-32)28-9-8-26-14-17-4-6-20(25)7-5-17;1-7-5-3-2-4-6-7;1-2/h1-7,10-13,16,26H,8-9,14-15H2,(H2,28,29,30,31);7H,2-6H2,1H3;1-2H2 |
| InChIKey | CEEREPWYSYYLQS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|