About 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol
3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol (PubChem CID 142039921) has the molecular formula C9H10O2S
and a molecular weight of 182.24 g/mol. Its IUPAC name is 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol.
Molecular Properties
| Compound Name | 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol |
| PubChem CID | 142039921 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol |
| SMILES | CC1CSc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C9H10O2S/c1-5-4-12-9-3-8(11)7(10)2-6(5)9/h2-3,5,10-11H,4H2,1H3 |
| InChIKey | OKWLYNXFOFUXCH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol?
The IUPAC name of 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol (CID 142039921) is 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol.
What is the SMILES notation for 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol?
The canonical SMILES for 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol is CC1CSc2cc(O)c(O)cc21.
What is the InChIKey of 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol?
The InChIKey is OKWLYNXFOFUXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c1-5-4-12-9-3-8(11)7(10)2-6(5)9/h2-3,5,10-11H,4H2,1H3.
What are the key properties of 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol?
3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol has a molecular weight of 182.24 g/mol, XLogP of 2.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,3-dihydro-1-benzothiophene-5,6-diol is sourced from PubChem (CID 142039921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).