About 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine
5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine (PubChem CID 142041016) has the molecular formula C8H12ClNO2S
and a molecular weight of 221.71 g/mol. Its IUPAC name is 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine.
Molecular Properties
| Compound Name | 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine |
| PubChem CID | 142041016 |
| Molecular Formula | C8H12ClNO2S |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine |
| SMILES | CNC.COc1c(C=O)csc1Cl |
| InChI | InChI=1S/C6H5ClO2S.C2H7N/c1-9-5-4(2-8)3-10-6(5)7;1-3-2/h2-3H,1H3;3H,1-2H3 |
| InChIKey | BJQVNPVAXQOGDM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine?
The IUPAC name of 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine (CID 142041016) is 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine.
What is the SMILES notation for 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine?
The canonical SMILES for 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine is CNC.COc1c(C=O)csc1Cl.
What is the InChIKey of 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine?
The InChIKey is BJQVNPVAXQOGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO2S.C2H7N/c1-9-5-4(2-8)3-10-6(5)7;1-3-2/h2-3H,1H3;3H,1-2H3.
What are the key properties of 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine?
5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine has a molecular weight of 221.71 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-methoxythiophene-3-carbaldehyde;N-methylmethanamine is sourced from PubChem (CID 142041016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).