About N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen
N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen (PubChem CID 142041392) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen |
| PubChem CID | 142041392 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen |
| SMILES | C=N/C(C)=C\C(C)=C/C.[H][H] |
| InChI | InChI=1S/C8H13N.H2/c1-5-7(2)6-8(3)9-4;/h5-6H,4H2,1-3H3;1H/b7-5-,8-6-; |
| InChIKey | QEWQDRGSTOMETR-OVDGFJEXSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen?
The IUPAC name of N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen (CID 142041392) is N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen.
What is the SMILES notation for N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen?
The canonical SMILES for N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen is C=N/C(C)=C\C(C)=C/C.[H][H].
What is the InChIKey of N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen?
The InChIKey is QEWQDRGSTOMETR-OVDGFJEXSA-N. The full InChI is InChI=1S/C8H13N.H2/c1-5-7(2)6-8(3)9-4;/h5-6H,4H2,1-3H3;1H/b7-5-,8-6-;.
What are the key properties of N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen?
N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen has a molecular weight of 125.21 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]methanimine;molecular hydrogen is sourced from PubChem (CID 142041392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).