C20H30O3 — CID 142041470
10,14,17,17-tetramethyl-6,18-dioxapentacyclo[10.4.2.01,13.03,10.04,7]octadec-13-en-9-ol (PubChem CID 142041470) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 10,14,17,17-tetramethyl-6,18-dioxapentacyclo[10.4.2.01,13.03,10.04,7]octadec-13-en-9-ol.
| Compound Name | 10,14,17,17-tetramethyl-6,18-dioxapentacyclo[10.4.2.01,13.03,10.04,7]octadec-13-en-9-ol |
|---|---|
| PubChem CID | 142041470 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 10,14,17,17-tetramethyl-6,18-dioxapentacyclo[10.4.2.01,13.03,10.04,7]octadec-13-en-9-ol |
| SMILES | CC1=C2C3CC4(C)C(O)CC5OCC5C4CC2(CC1)C(C)(C)O3 |
| InChI | InChI=1S/C20H30O3/c1-11-5-6-20-8-13-12-10-22-14(12)7-16(21)19(13,4)9-15(17(11)20)23-18(20,2)3/h12-16,21H,5-10H2,1-4H3 |
| InChIKey | ZTCVEBWRARXJQG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|