3-cyclopentylpropanamide;molecular hydrogen

C8H17NO — CID 142041552

IUPAC3-cyclopentylpropanamide;molecular hydrogen
SMILESNC(=O)CCC1CCCC1.[H][H]
InChIInChI=1S/C8H15NO.H2/c9-8(10)6-5-7-3-1-2-4-7;/h7H,1-6H2,(H2,9,10);1H
InChIKeyJYTSNJYQKCBCCQ-UHFFFAOYSA-N
MW143.23 g/mol
LogP1.69
Rot. Bonds3

About 3-cyclopentylpropanamide;molecular hydrogen

3-cyclopentylpropanamide;molecular hydrogen (PubChem CID 142041552) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-cyclopentylpropanamide;molecular hydrogen.

Molecular Properties

Compound Name3-cyclopentylpropanamide;molecular hydrogen
PubChem CID142041552
Molecular FormulaC8H17NO
Molecular Weight143.23 g/mol
Exact Mass143.13
IUPAC Name3-cyclopentylpropanamide;molecular hydrogen
SMILESNC(=O)CCC1CCCC1.[H][H]
InChIInChI=1S/C8H15NO.H2/c9-8(10)6-5-7-3-1-2-4-7;/h7H,1-6H2,(H2,9,10);1H
InChIKeyJYTSNJYQKCBCCQ-UHFFFAOYSA-N
XLogP1.69
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.23
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3-cyclopentylpropanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclopentylpropanamide;molecular hydrogen?
The IUPAC name of 3-cyclopentylpropanamide;molecular hydrogen (CID 142041552) is 3-cyclopentylpropanamide;molecular hydrogen.
What is the SMILES notation for 3-cyclopentylpropanamide;molecular hydrogen?
The canonical SMILES for 3-cyclopentylpropanamide;molecular hydrogen is NC(=O)CCC1CCCC1.[H][H].
What is the InChIKey of 3-cyclopentylpropanamide;molecular hydrogen?
The InChIKey is JYTSNJYQKCBCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.H2/c9-8(10)6-5-7-3-1-2-4-7;/h7H,1-6H2,(H2,9,10);1H.
What are the key properties of 3-cyclopentylpropanamide;molecular hydrogen?
3-cyclopentylpropanamide;molecular hydrogen has a molecular weight of 143.23 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpropanamide;molecular hydrogen is sourced from PubChem (CID 142041552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).