About 3-cyclopentylpropanamide;molecular hydrogen
3-cyclopentylpropanamide;molecular hydrogen (PubChem CID 142041552) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 3-cyclopentylpropanamide;molecular hydrogen.
Molecular Properties
| Compound Name | 3-cyclopentylpropanamide;molecular hydrogen |
| PubChem CID | 142041552 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 3-cyclopentylpropanamide;molecular hydrogen |
| SMILES | NC(=O)CCC1CCCC1.[H][H] |
| InChI | InChI=1S/C8H15NO.H2/c9-8(10)6-5-7-3-1-2-4-7;/h7H,1-6H2,(H2,9,10);1H |
| InChIKey | JYTSNJYQKCBCCQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclopentylpropanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentylpropanamide;molecular hydrogen?
The IUPAC name of 3-cyclopentylpropanamide;molecular hydrogen (CID 142041552) is 3-cyclopentylpropanamide;molecular hydrogen.
What is the SMILES notation for 3-cyclopentylpropanamide;molecular hydrogen?
The canonical SMILES for 3-cyclopentylpropanamide;molecular hydrogen is NC(=O)CCC1CCCC1.[H][H].
What is the InChIKey of 3-cyclopentylpropanamide;molecular hydrogen?
The InChIKey is JYTSNJYQKCBCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.H2/c9-8(10)6-5-7-3-1-2-4-7;/h7H,1-6H2,(H2,9,10);1H.
What are the key properties of 3-cyclopentylpropanamide;molecular hydrogen?
3-cyclopentylpropanamide;molecular hydrogen has a molecular weight of 143.23 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentylpropanamide;molecular hydrogen is sourced from PubChem (CID 142041552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).