C21H34N4O4 — CID 142041834
(9S)-2-methylidene-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione (PubChem CID 142041834) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is (9S)-2-methylidene-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione.
| Compound Name | (9S)-2-methylidene-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
|---|---|
| PubChem CID | 142041834 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (9S)-2-methylidene-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
| SMILES | C=C1CNC(=O)CNC(=O)[C@H](CCCCCC(=O)CC)NC(=O)C2CCCCN12 |
| InChI | InChI=1S/C21H34N4O4/c1-3-16(26)9-5-4-6-10-17-20(28)23-14-19(27)22-13-15(2)25-12-8-7-11-18(25)21(29)24-17/h17-18H,2-14H2,1H3,(H,22,27)(H,23,28)(H,24,29)/t17-,18?/m0/s1 |
| InChIKey | LFBPZMCMBSPLGV-ZENAZSQFSA-N |
| XLogP | 1.01 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|