C28H53N5O6 — CID 142041873
butane;N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide;octan-3-ol (PubChem CID 142041873) has the molecular formula C28H53N5O6 and a molecular weight of 555.76 g/mol. Its IUPAC name is butane;N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide;octan-3-ol.
| Compound Name | butane;N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide;octan-3-ol |
|---|---|
| PubChem CID | 142041873 |
| Molecular Formula | C28H53N5O6 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.40 |
| IUPAC Name | butane;N-methoxy-N-methyl-2-methylidene-5,8,11-trioxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-6-carboxamide;octan-3-ol |
| SMILES | C=C1CNC(=O)C(C(=O)N(C)OC)NC(=O)CNC(=O)C2CCCCN12.CCCC.CCCCCC(O)CC |
| InChI | InChI=1S/C16H25N5O5.C8H18O.C4H10/c1-10-8-17-15(24)13(16(25)20(2)26-3)19-12(22)9-18-14(23)11-6-4-5-7-21(10)11;1-3-5-6-7-8(9)4-2;1-3-4-2/h11,13H,1,4-9H2,2-3H3,(H,17,24)(H,18,23)(H,19,22);8-9H,3-7H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | RYANTBZRVDXIAJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|